C50H56N2 — CID 143143573
2-tert-butyl-10-N-[(2Z,4Z)-4-ethylhepta-2,4,6-trienyl]-9-N-(4-ethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine;methane (PubChem CID 143143573) has the molecular formula C50H56N2 and a molecular weight of 685.01 g/mol. Its IUPAC name is 2-tert-butyl-10-N-[(2Z,4Z)-4-ethylhepta-2,4,6-trienyl]-9-N-(4-ethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine;methane.
| Compound Name | 2-tert-butyl-10-N-[(2Z,4Z)-4-ethylhepta-2,4,6-trienyl]-9-N-(4-ethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine;methane |
|---|---|
| PubChem CID | 143143573 |
| Molecular Formula | C50H56N2 |
| Molecular Weight | 685.01 g/mol |
| Exact Mass | 684.44 |
| IUPAC Name | 2-tert-butyl-10-N-[(2Z,4Z)-4-ethylhepta-2,4,6-trienyl]-9-N-(4-ethylphenyl)-9-N,10-N-bis(4-methylphenyl)anthracene-9,10-diamine;methane |
| SMILES | C.C=C/C=C(\C=C/CN(c1ccc(C)cc1)c1c2ccccc2c(N(c2ccc(C)cc2)c2ccc(CC)cc2)c2cc(C(C)(C)C)ccc12)CC |
| InChI | InChI=1S/C49H52N2.CH4/c1-9-15-37(10-2)16-14-33-50(40-26-19-35(4)20-27-40)47-43-17-12-13-18-44(43)48(46-34-39(49(6,7)8)25-32-45(46)47)51(41-28-21-36(5)22-29-41)42-30-23-38(11-3)24-31-42;/h9,12-32,34H,1,10-11,33H2,2-8H3;1H4/b16-14-,37-15-; |
| InChIKey | NVDARUKPQNYGMD-TUMBAYAUSA-N |
| XLogP | 14.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.01 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|