C17H34N2 — CID 143143747
ethane;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane (PubChem CID 143143747) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is ethane;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane.
| Compound Name | ethane;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 143143747 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | ethane;7-methyl-7-azabicyclo[2.2.1]heptane;2-methyl-2-azabicyclo[2.2.2]octane |
| SMILES | CC.CN1C2CCC1CC2.CN1CC2CCC1CC2 |
| InChI | InChI=1S/C8H15N.C7H13N.C2H6/c1-9-6-7-2-4-8(9)5-3-7;1-8-6-2-3-7(8)5-4-6;1-2/h7-8H,2-6H2,1H3;6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | UGJWICNZETWUHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |