C17H23N — CID 143143751
1-(3-ethenyl-4-ethyl-1-phenylcyclopent-3-en-1-yl)-N-methylmethanamine (PubChem CID 143143751) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-(3-ethenyl-4-ethyl-1-phenylcyclopent-3-en-1-yl)-N-methylmethanamine.
| Compound Name | 1-(3-ethenyl-4-ethyl-1-phenylcyclopent-3-en-1-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 143143751 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-(3-ethenyl-4-ethyl-1-phenylcyclopent-3-en-1-yl)-N-methylmethanamine |
| SMILES | C=CC1=C(CC)CC(CNC)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H23N/c1-4-14-11-17(13-18-3,12-15(14)5-2)16-9-7-6-8-10-16/h4,6-10,18H,1,5,11-13H2,2-3H3 |
| InChIKey | OJQSCLXGMRLTKW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |