C15H22FN — CID 143143754
1-[(2S,3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-3-methyl-5-methylidenepiperidine (PubChem CID 143143754) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-[(2S,3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-3-methyl-5-methylidenepiperidine.
| Compound Name | 1-[(2S,3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-3-methyl-5-methylidenepiperidine |
|---|---|
| PubChem CID | 143143754 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[(2S,3Z)-3-(1-fluoroethenyl)hexa-3,5-dien-2-yl]-3-methyl-5-methylidenepiperidine |
| SMILES | C=C/C=C(\C(=C)F)[C@H](C)N1CC(=C)CC(C)C1 |
| InChI | InChI=1S/C15H22FN/c1-6-7-15(13(4)16)14(5)17-9-11(2)8-12(3)10-17/h6-7,12,14H,1-2,4,8-10H2,3,5H3/b15-7+/t12?,14-/m0/s1 |
| InChIKey | UNTBNOJNUUGDGC-PQSUJBPVSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|