About 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one
1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one (PubChem CID 143143975) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one |
| PubChem CID | 143143975 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one |
| SMILES | CC(=O)Cn1cnc2c1CCC=C2 |
| InChI | InChI=1S/C10H12N2O/c1-8(13)6-12-7-11-9-4-2-3-5-10(9)12/h2,4,7H,3,5-6H2,1H3 |
| InChIKey | DBOMBUOCZOTTCU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one?
The IUPAC name of 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one (CID 143143975) is 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one.
What is the SMILES notation for 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one?
The canonical SMILES for 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one is CC(=O)Cn1cnc2c1CCC=C2.
What is the InChIKey of 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one?
The InChIKey is DBOMBUOCZOTTCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-8(13)6-12-7-11-9-4-2-3-5-10(9)12/h2,4,7H,3,5-6H2,1H3.
What are the key properties of 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one?
1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one has a molecular weight of 176.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydrobenzimidazol-1-yl)propan-2-one is sourced from PubChem (CID 143143975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).