C21H32N4O — CID 143145536
2-ethenyl-1-methyl-3-[[methyl(4-phenylbutyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazinan-5-one (PubChem CID 143145536) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-ethenyl-1-methyl-3-[[methyl(4-phenylbutyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazinan-5-one.
| Compound Name | 2-ethenyl-1-methyl-3-[[methyl(4-phenylbutyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazinan-5-one |
|---|---|
| PubChem CID | 143145536 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 2-ethenyl-1-methyl-3-[[methyl(4-phenylbutyl)amino]methyl]-4-prop-2-enyl-1,2,4-triazinan-5-one |
| SMILES | C=CCN1C(=O)CN(C)N(C=C)C1CN(C)CCCCc1ccccc1 |
| InChI | InChI=1S/C21H32N4O/c1-5-15-24-20(25(6-2)23(4)18-21(24)26)17-22(3)16-11-10-14-19-12-8-7-9-13-19/h5-9,12-13,20H,1-2,10-11,14-18H2,3-4H3 |
| InChIKey | FJEOWGOOWSFAGN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|