C27H33N5O6 — CID 143145777
3-[(9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(1-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid (PubChem CID 143145777) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 3-[(9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(1-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid.
| Compound Name | 3-[(9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(1-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 143145777 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 3-[(9aS)-1-[(4-methoxyphenyl)methylcarbamoyl]-2-methyl-4,7-dioxo-8-(1-phenylethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
| SMILES | COc1ccc(CNC(=O)N2[C@H]3CN(C(C)c4ccccc4)C(=O)C(CCC(=O)O)N3C(=O)CN2C)cc1 |
| InChI | InChI=1S/C27H33N5O6/c1-18(20-7-5-4-6-8-20)30-16-23-31(22(26(30)36)13-14-25(34)35)24(33)17-29(2)32(23)27(37)28-15-19-9-11-21(38-3)12-10-19/h4-12,18,22-23H,13-17H2,1-3H3,(H,28,37)(H,34,35)/t18?,22?,23-/m0/s1 |
| InChIKey | AEZXOVYRGXFGMU-CKRJSAQMSA-N |
| XLogP | 2.06 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |