About 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine
2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine (PubChem CID 143146397) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine.
Molecular Properties
| Compound Name | 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine |
| PubChem CID | 143146397 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine |
| SMILES | C/C=N/C1=C(NC)CCCC1C |
| InChI | InChI=1S/C10H18N2/c1-4-12-10-8(2)6-5-7-9(10)11-3/h4,8,11H,5-7H2,1-3H3/b12-4+ |
| InChIKey | QSRHKWQUODMUKH-UUILKARUSA-N |
| XLogP | 2.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine?
The IUPAC name of 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine (CID 143146397) is 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine.
What is the SMILES notation for 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine?
The canonical SMILES for 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine is C/C=N/C1=C(NC)CCCC1C.
What is the InChIKey of 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine?
The InChIKey is QSRHKWQUODMUKH-UUILKARUSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-12-10-8(2)6-5-7-9(10)11-3/h4,8,11H,5-7H2,1-3H3/b12-4+.
What are the key properties of 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine?
2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylideneamino)-N,3-dimethylcyclohexen-1-amine is sourced from PubChem (CID 143146397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).