C22H19BF2N4O3 — CID 143146421
N-[(3-aminophenyl)methyl]-2-(2-difluoroboranyl-8-methoxyquinolin-5-yl)-5-methyl-1,3-oxazole-4-carboxamide (PubChem CID 143146421) has the molecular formula C22H19BF2N4O3 and a molecular weight of 436.23 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-2-(2-difluoroboranyl-8-methoxyquinolin-5-yl)-5-methyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3-aminophenyl)methyl]-2-(2-difluoroboranyl-8-methoxyquinolin-5-yl)-5-methyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 143146421 |
| Molecular Formula | C22H19BF2N4O3 |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-2-(2-difluoroboranyl-8-methoxyquinolin-5-yl)-5-methyl-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(-c2nc(C(=O)NCc3cccc(N)c3)c(C)o2)c2ccc(B(F)F)nc12 |
| InChI | InChI=1S/C22H19BF2N4O3/c1-12-19(21(30)27-11-13-4-3-5-14(26)10-13)29-22(32-12)16-6-8-17(31-2)20-15(16)7-9-18(28-20)23(24)25/h3-10H,11,26H2,1-2H3,(H,27,30) |
| InChIKey | PJZHBCQOIOOELA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|