C24H29FN4O3 — CID 143146460
5-[(2R)-2-aminobut-3-enyl]-2-[2-(3-fluorohexan-3-yl)-8-methoxyquinolin-5-yl]-1,3-oxazole-4-carboxamide (PubChem CID 143146460) has the molecular formula C24H29FN4O3 and a molecular weight of 440.52 g/mol. Its IUPAC name is 5-[(2R)-2-aminobut-3-enyl]-2-[2-(3-fluorohexan-3-yl)-8-methoxyquinolin-5-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-[(2R)-2-aminobut-3-enyl]-2-[2-(3-fluorohexan-3-yl)-8-methoxyquinolin-5-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 143146460 |
| Molecular Formula | C24H29FN4O3 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 5-[(2R)-2-aminobut-3-enyl]-2-[2-(3-fluorohexan-3-yl)-8-methoxyquinolin-5-yl]-1,3-oxazole-4-carboxamide |
| SMILES | C=C[C@H](N)Cc1oc(-c2ccc(OC)c3nc(C(F)(CC)CCC)ccc23)nc1C(N)=O |
| InChI | InChI=1S/C24H29FN4O3/c1-5-12-24(25,7-3)19-11-9-15-16(8-10-17(31-4)20(15)28-19)23-29-21(22(27)30)18(32-23)13-14(26)6-2/h6,8-11,14H,2,5,7,12-13,26H2,1,3-4H3,(H2,27,30)/t14-,24?/m0/s1 |
| InChIKey | GPSLGRMTZLNLMW-LNYMIDHXSA-N |
| XLogP | 4.43 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|