About ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene
ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene (PubChem CID 143146527) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene.
Molecular Properties
| Compound Name | ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene |
| PubChem CID | 143146527 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene |
| SMILES | CC.CC.CCC1=NOC2C=C1CCCC2 |
| InChI | InChI=1S/C10H15NO.2C2H6/c1-2-10-8-5-3-4-6-9(7-8)12-11-10;2*1-2/h7,9H,2-6H2,1H3;2*1-2H3 |
| InChIKey | HJIXZQLELGRNDA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene?
The IUPAC name of ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene (CID 143146527) is ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene.
What is the SMILES notation for ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene?
The canonical SMILES for ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene is CC.CC.CCC1=NOC2C=C1CCCC2.
What is the InChIKey of ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene?
The InChIKey is HJIXZQLELGRNDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.2C2H6/c1-2-10-8-5-3-4-6-9(7-8)12-11-10;2*1-2/h7,9H,2-6H2,1H3;2*1-2H3.
What are the key properties of ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene?
ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene has a molecular weight of 225.38 g/mol, XLogP of 4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-ethyl-7-oxa-8-azabicyclo[4.3.1]deca-1(10),8-diene is sourced from PubChem (CID 143146527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).