About 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane
2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane (PubChem CID 143147028) has the molecular formula C15H30N2OS
and a molecular weight of 286.48 g/mol. Its IUPAC name is 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane.
Molecular Properties
| Compound Name | 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane |
| PubChem CID | 143147028 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.48 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane |
| SMILES | C.CCC(CC)CC(C)/N=C1/NC(=O)C(C(C)C)S1 |
| InChI | InChI=1S/C14H26N2OS.CH4/c1-6-11(7-2)8-10(5)15-14-16-13(17)12(18-14)9(3)4;/h9-12H,6-8H2,1-5H3,(H,15,16,17);1H4 |
| InChIKey | FKFLONYVUMMYOD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane?
The IUPAC name of 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane (CID 143147028) is 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane.
What is the SMILES notation for 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane?
The canonical SMILES for 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane is C.CCC(CC)CC(C)/N=C1/NC(=O)C(C(C)C)S1.
What is the InChIKey of 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane?
The InChIKey is FKFLONYVUMMYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2OS.CH4/c1-6-11(7-2)8-10(5)15-14-16-13(17)12(18-14)9(3)4;/h9-12H,6-8H2,1-5H3,(H,15,16,17);1H4.
What are the key properties of 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane?
2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane has a molecular weight of 286.48 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylhexan-2-ylimino)-5-propan-2-yl-1,3-thiazolidin-4-one;methane is sourced from PubChem (CID 143147028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).