About 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide
2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide (PubChem CID 143147211) has the molecular formula C6H9N3O2S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide |
| PubChem CID | 143147211 |
| Molecular Formula | C6H9N3O2S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide |
| SMILES | CC1(CC(N)=O)SC(N)=NC1=O |
| InChI | InChI=1S/C6H9N3O2S/c1-6(2-3(7)10)4(11)9-5(8)12-6/h2H2,1H3,(H2,7,10)(H2,8,9,11) |
| InChIKey | YMJQAQFTBKBMLW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide?
The IUPAC name of 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide (CID 143147211) is 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide.
What is the SMILES notation for 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide?
The canonical SMILES for 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide is CC1(CC(N)=O)SC(N)=NC1=O.
What is the InChIKey of 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide?
The InChIKey is YMJQAQFTBKBMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2S/c1-6(2-3(7)10)4(11)9-5(8)12-6/h2H2,1H3,(H2,7,10)(H2,8,9,11).
What are the key properties of 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide?
2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide has a molecular weight of 187.22 g/mol, XLogP of -0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5-methyl-4-oxo-1,3-thiazol-5-yl)acetamide is sourced from PubChem (CID 143147211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).