C29H35NO6S — CID 143147332
2-[4-[[5-[(E)-4-methoxypent-3-en-2-yl]-4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]-2-methylphenoxy]acetic acid;prop-1-ene (PubChem CID 143147332) has the molecular formula C29H35NO6S and a molecular weight of 525.67 g/mol. Its IUPAC name is 2-[4-[[5-[(E)-4-methoxypent-3-en-2-yl]-4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]-2-methylphenoxy]acetic acid;prop-1-ene.
| Compound Name | 2-[4-[[5-[(E)-4-methoxypent-3-en-2-yl]-4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]-2-methylphenoxy]acetic acid;prop-1-ene |
|---|---|
| PubChem CID | 143147332 |
| Molecular Formula | C29H35NO6S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 2-[4-[[5-[(E)-4-methoxypent-3-en-2-yl]-4-(3-methoxyphenyl)-1,3-thiazol-2-yl]methoxy]-2-methylphenoxy]acetic acid;prop-1-ene |
| SMILES | C=CC.CO/C(C)=C/C(C)c1sc(COc2ccc(OCC(=O)O)c(C)c2)nc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C26H29NO6S.C3H6/c1-16-12-21(9-10-22(16)33-15-24(28)29)32-14-23-27-25(19-7-6-8-20(13-19)31-5)26(34-23)17(2)11-18(3)30-4;1-3-2/h6-13,17H,14-15H2,1-5H3,(H,28,29);3H,1H2,2H3/b18-11+; |
| InChIKey | WQSWXCIQLFBRFW-NWBUNABESA-N |
| XLogP | 7.02 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|