C32H23F3INO3S — CID 143147394
2-[2-methyl-4-[[5-(4-phenylphenyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methoxy]phenoxy]acetyl iodide (PubChem CID 143147394) has the molecular formula C32H23F3INO3S and a molecular weight of 685.51 g/mol. Its IUPAC name is 2-[2-methyl-4-[[5-(4-phenylphenyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methoxy]phenoxy]acetyl iodide.
| Compound Name | 2-[2-methyl-4-[[5-(4-phenylphenyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methoxy]phenoxy]acetyl iodide |
|---|---|
| PubChem CID | 143147394 |
| Molecular Formula | C32H23F3INO3S |
| Molecular Weight | 685.51 g/mol |
| Exact Mass | 685.04 |
| IUPAC Name | 2-[2-methyl-4-[[5-(4-phenylphenyl)-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]methoxy]phenoxy]acetyl iodide |
| SMILES | Cc1cc(OCc2nc(-c3ccc(C(F)(F)F)cc3)c(-c3ccc(-c4ccccc4)cc3)s2)ccc1OCC(=O)I |
| InChI | InChI=1S/C32H23F3INO3S/c1-20-17-26(15-16-27(20)40-18-28(36)38)39-19-29-37-30(23-11-13-25(14-12-23)32(33,34)35)31(41-29)24-9-7-22(8-10-24)21-5-3-2-4-6-21/h2-17H,18-19H2,1H3 |
| InChIKey | ZJZLJUQJXHUMBB-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.51 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|