About ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole
ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole (PubChem CID 143147510) has the molecular formula C16H29NS
and a molecular weight of 267.48 g/mol. Its IUPAC name is ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole.
Molecular Properties
| Compound Name | ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole |
| PubChem CID | 143147510 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole |
| SMILES | CC.CC.CCC1NSc2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C12H17NS.2C2H6/c1-4-11-10-6-5-9(8(2)3)7-12(10)14-13-11;2*1-2/h5-8,11,13H,4H2,1-3H3;2*1-2H3 |
| InChIKey | DEQABZTYIRRLDT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole?
The IUPAC name of ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole (CID 143147510) is ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole.
What is the SMILES notation for ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole?
The canonical SMILES for ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole is CC.CC.CCC1NSc2cc(C(C)C)ccc21.
What is the InChIKey of ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole?
The InChIKey is DEQABZTYIRRLDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS.2C2H6/c1-4-11-10-6-5-9(8(2)3)7-12(10)14-13-11;2*1-2/h5-8,11,13H,4H2,1-3H3;2*1-2H3.
What are the key properties of ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole?
ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole has a molecular weight of 267.48 g/mol, XLogP of 5.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-6-propan-2-yl-2,3-dihydro-1,2-benzothiazole is sourced from PubChem (CID 143147510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).