C23H21F2N3O5S — CID 143148272
butyl 3-cyano-2-[[(E)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (PubChem CID 143148272) has the molecular formula C23H21F2N3O5S and a molecular weight of 489.50 g/mol. Its IUPAC name is butyl 3-cyano-2-[[(E)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate.
| Compound Name | butyl 3-cyano-2-[[(E)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 143148272 |
| Molecular Formula | C23H21F2N3O5S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | butyl 3-cyano-2-[[(E)-3-(2,2-difluoro-1,3-benzodioxol-4-yl)prop-2-enoyl]amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| SMILES | CCCCOC(=O)N1CCc2c(sc(NC(=O)/C=C/c3cccc4c3OC(F)(F)O4)c2C#N)C1 |
| InChI | InChI=1S/C23H21F2N3O5S/c1-2-3-11-31-22(30)28-10-9-15-16(12-26)21(34-18(15)13-28)27-19(29)8-7-14-5-4-6-17-20(14)33-23(24,25)32-17/h4-8H,2-3,9-11,13H2,1H3,(H,27,29)/b8-7+ |
| InChIKey | WOZLSKIYIDXKGR-BQYQJAHWSA-N |
| XLogP | 4.89 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|