C10H17N3 — CID 143148585
ethane;1-[(E)-2-ethenylbut-2-enyl]-1,2,4-triazole (PubChem CID 143148585) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is ethane;1-[(E)-2-ethenylbut-2-enyl]-1,2,4-triazole.
| Compound Name | ethane;1-[(E)-2-ethenylbut-2-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 143148585 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | ethane;1-[(E)-2-ethenylbut-2-enyl]-1,2,4-triazole |
| SMILES | C=C/C(=C\C)Cn1cncn1.CC |
| InChI | InChI=1S/C8H11N3.C2H6/c1-3-8(4-2)5-11-7-9-6-10-11;1-2/h3-4,6-7H,1,5H2,2H3;1-2H3/b8-4+; |
| InChIKey | TYEICLPDUYTYEV-ZFXMFRGYSA-N |
| XLogP | 2.44 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|