About bicyclo[3.1.0]hexane-2,4-dione;hydrochloride
bicyclo[3.1.0]hexane-2,4-dione;hydrochloride (PubChem CID 143148645) has the molecular formula C6H7ClO2
and a molecular weight of 146.57 g/mol. Its IUPAC name is bicyclo[3.1.0]hexane-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| PubChem CID | 143148645 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | bicyclo[3.1.0]hexane-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CC(=O)C2CC12 |
| InChI | InChI=1S/C6H6O2.ClH/c7-5-2-6(8)4-1-3(4)5;/h3-4H,1-2H2;1H |
| InChIKey | JCHMCSJPVWSTMD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexane-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexane-2,4-dione;hydrochloride?
The IUPAC name of bicyclo[3.1.0]hexane-2,4-dione;hydrochloride (CID 143148645) is bicyclo[3.1.0]hexane-2,4-dione;hydrochloride.
What is the SMILES notation for bicyclo[3.1.0]hexane-2,4-dione;hydrochloride?
The canonical SMILES for bicyclo[3.1.0]hexane-2,4-dione;hydrochloride is Cl.O=C1CC(=O)C2CC12.
What is the InChIKey of bicyclo[3.1.0]hexane-2,4-dione;hydrochloride?
The InChIKey is JCHMCSJPVWSTMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.ClH/c7-5-2-6(8)4-1-3(4)5;/h3-4H,1-2H2;1H.
What are the key properties of bicyclo[3.1.0]hexane-2,4-dione;hydrochloride?
bicyclo[3.1.0]hexane-2,4-dione;hydrochloride has a molecular weight of 146.57 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexane-2,4-dione;hydrochloride is sourced from PubChem (CID 143148645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).