C21H35NO2 — CID 143148922
2-ethyl-4-[1-(2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)ethyl]-5-methylpyrrolidin-3-one (PubChem CID 143148922) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-ethyl-4-[1-(2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)ethyl]-5-methylpyrrolidin-3-one.
| Compound Name | 2-ethyl-4-[1-(2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)ethyl]-5-methylpyrrolidin-3-one |
|---|---|
| PubChem CID | 143148922 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 2-ethyl-4-[1-(2-hydroxy-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)ethyl]-5-methylpyrrolidin-3-one |
| SMILES | CCC1NC(C)C(C(C)C2(C)C(O)C=CC3CC(C)CCC32)C1=O |
| InChI | InChI=1S/C21H35NO2/c1-6-17-20(24)19(14(4)22-17)13(3)21(5)16-9-7-12(2)11-15(16)8-10-18(21)23/h8,10,12-19,22-23H,6-7,9,11H2,1-5H3 |
| InChIKey | FLKRRJYBSAWKDR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|