C28H30FN5O3 — CID 143149047
ethane;(6Z)-2-[(4-fluorophenyl)methyl]-6-hydrazinylidene-8-(methylideneamino)-9-phenylmethoxy-7-[(Z)-prop-1-enyl]-3H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 143149047) has the molecular formula C28H30FN5O3 and a molecular weight of 503.58 g/mol. Its IUPAC name is ethane;(6Z)-2-[(4-fluorophenyl)methyl]-6-hydrazinylidene-8-(methylideneamino)-9-phenylmethoxy-7-[(Z)-prop-1-enyl]-3H-pyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | ethane;(6Z)-2-[(4-fluorophenyl)methyl]-6-hydrazinylidene-8-(methylideneamino)-9-phenylmethoxy-7-[(Z)-prop-1-enyl]-3H-pyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 143149047 |
| Molecular Formula | C28H30FN5O3 |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | ethane;(6Z)-2-[(4-fluorophenyl)methyl]-6-hydrazinylidene-8-(methylideneamino)-9-phenylmethoxy-7-[(Z)-prop-1-enyl]-3H-pyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | C=Nc1c(OCc2ccccc2)c2n(/c(=N\N)c1/C=C\C)C(=O)CN(Cc1ccc(F)cc1)C2=O.CC |
| InChI | InChI=1S/C26H24FN5O3.C2H6/c1-3-7-20-22(29-2)24(35-16-18-8-5-4-6-9-18)23-26(34)31(14-17-10-12-19(27)13-11-17)15-21(33)32(23)25(20)30-28;1-2/h3-13H,2,14-16,28H2,1H3;1-2H3/b7-3-,30-25-; |
| InChIKey | XJSVOYRBJAYGSS-LLOCPQJVSA-N |
| XLogP | 4.67 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|