C18H28O4 — CID 143149320
11-(3,5-dihydroxyphenyl)undecan-4-yl formate (PubChem CID 143149320) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 11-(3,5-dihydroxyphenyl)undecan-4-yl formate.
| Compound Name | 11-(3,5-dihydroxyphenyl)undecan-4-yl formate |
|---|---|
| PubChem CID | 143149320 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 11-(3,5-dihydroxyphenyl)undecan-4-yl formate |
| SMILES | CCCC(CCCCCCCc1cc(O)cc(O)c1)OC=O |
| InChI | InChI=1S/C18H28O4/c1-2-8-18(22-14-19)10-7-5-3-4-6-9-15-11-16(20)13-17(21)12-15/h11-14,18,20-21H,2-10H2,1H3 |
| InChIKey | BMFLNTYMTXSNCK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|