About [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium
[(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium (PubChem CID 143149422) has the molecular formula C12H16ClN2O2+
and a molecular weight of 255.73 g/mol. Its IUPAC name is [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium.
Molecular Properties
| Compound Name | [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium |
| PubChem CID | 143149422 |
| Molecular Formula | C12H16ClN2O2+ |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium |
| SMILES | C/C=C(\C=C(\Cl)[NH2+]O)C(O)c1ccc(N)cc1 |
| InChI | InChI=1S/C12H15ClN2O2/c1-2-8(7-11(13)15-17)12(16)9-3-5-10(14)6-4-9/h2-7,12,15-17H,14H2,1H3/p+1/b8-2+,11-7- |
| InChIKey | UVEMEOWWKJRHRV-UKARJAEVSA-O |
| XLogP | 1.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium?
The IUPAC name of [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium (CID 143149422) is [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium.
What is the SMILES notation for [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium?
The canonical SMILES for [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium is C/C=C(\C=C(\Cl)[NH2+]O)C(O)c1ccc(N)cc1.
What is the InChIKey of [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium?
The InChIKey is UVEMEOWWKJRHRV-UKARJAEVSA-O. The full InChI is InChI=1S/C12H15ClN2O2/c1-2-8(7-11(13)15-17)12(16)9-3-5-10(14)6-4-9/h2-7,12,15-17H,14H2,1H3/p+1/b8-2+,11-7-.
What are the key properties of [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium?
[(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium has a molecular weight of 255.73 g/mol, XLogP of 1.28, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-3-[(4-aminophenyl)-hydroxymethyl]-1-chloropenta-1,3-dienyl]-hydroxyazanium is sourced from PubChem (CID 143149422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).