About 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine
3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine (PubChem CID 143149448) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine.
Molecular Properties
| Compound Name | 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine |
| PubChem CID | 143149448 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine |
| SMILES | C=C(CC=C/C(=C\C)[N+](=O)[O-])COc1ccncc1C#CCOC |
| InChI | InChI=1S/C18H20N2O4/c1-4-17(20(21)22)9-5-7-15(2)14-24-18-10-11-19-13-16(18)8-6-12-23-3/h4-5,9-11,13H,2,7,12,14H2,1,3H3/b9-5?,17-4+ |
| InChIKey | GLDAFTLFTVUCQD-GSHLMNCYSA-N |
| XLogP | 3.14 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine?
The IUPAC name of 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine (CID 143149448) is 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine.
What is the SMILES notation for 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine?
The canonical SMILES for 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine is C=C(CC=C/C(=C\C)[N+](=O)[O-])COc1ccncc1C#CCOC.
What is the InChIKey of 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine?
The InChIKey is GLDAFTLFTVUCQD-GSHLMNCYSA-N. The full InChI is InChI=1S/C18H20N2O4/c1-4-17(20(21)22)9-5-7-15(2)14-24-18-10-11-19-13-16(18)8-6-12-23-3/h4-5,9-11,13H,2,7,12,14H2,1,3H3/b9-5?,17-4+.
What are the key properties of 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine?
3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine has a molecular weight of 328.37 g/mol, XLogP of 3.14, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methoxyprop-1-ynyl)-4-[(6E)-2-methylidene-6-nitroocta-4,6-dienoxy]pyridine is sourced from PubChem (CID 143149448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).