C17H16F3N3O2 — CID 143149532
2,2,2-trifluoroethyl 2-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]butanoate (PubChem CID 143149532) has the molecular formula C17H16F3N3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]butanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]butanoate |
|---|---|
| PubChem CID | 143149532 |
| Molecular Formula | C17H16F3N3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(dicyanomethylidene)-4-[4-(dimethylamino)phenyl]butanoate |
| SMILES | CN(C)c1ccc(CCC(C(=O)OCC(F)(F)F)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H16F3N3O2/c1-23(2)14-6-3-12(4-7-14)5-8-15(13(9-21)10-22)16(24)25-11-17(18,19)20/h3-4,6-7H,5,8,11H2,1-2H3 |
| InChIKey | WYXNOSAZBYRCAG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|