C15H21F2OP — CID 143149589
[2,3-difluoro-4-[(1-methoxy-4-methylcyclohexyl)methyl]phenyl]phosphane (PubChem CID 143149589) has the molecular formula C15H21F2OP and a molecular weight of 286.30 g/mol. Its IUPAC name is [2,3-difluoro-4-[(1-methoxy-4-methylcyclohexyl)methyl]phenyl]phosphane.
| Compound Name | [2,3-difluoro-4-[(1-methoxy-4-methylcyclohexyl)methyl]phenyl]phosphane |
|---|---|
| PubChem CID | 143149589 |
| Molecular Formula | C15H21F2OP |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | [2,3-difluoro-4-[(1-methoxy-4-methylcyclohexyl)methyl]phenyl]phosphane |
| SMILES | COC1(Cc2ccc(P)c(F)c2F)CCC(C)CC1 |
| InChI | InChI=1S/C15H21F2OP/c1-10-5-7-15(18-2,8-6-10)9-11-3-4-12(19)14(17)13(11)16/h3-4,10H,5-9,19H2,1-2H3 |
| InChIKey | QMNLXZAKJQGSIE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|