C27H48O7 — CID 143150268
methanol;(9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 143150268) has the molecular formula C27H48O7 and a molecular weight of 484.67 g/mol. Its IUPAC name is methanol;(9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | methanol;(9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 143150268 |
| Molecular Formula | C27H48O7 |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | methanol;(9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CC1=C\[C@H](CO[C@H]2CCC[C@@H](C)O2)[C@@H](C)OC(=O)CCCCCC[C@@H](C)C(=O)\C=C\1.CO.CO |
| InChI | InChI=1S/C25H40O5.2CH4O/c1-18-14-15-23(26)19(2)10-7-5-6-8-12-24(27)30-21(4)22(16-18)17-28-25-13-9-11-20(3)29-25;2*1-2/h14-16,19-22,25H,5-13,17H2,1-4H3;2*2H,1H3/b15-14+,18-16+;;/t19-,20-,21-,22-,25-;;/m1../s1 |
| InChIKey | VKBOLCNHVAMHLZ-AVLCHQBQSA-N |
| XLogP | 4.74 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |