C25H40O5 — CID 143150269
(9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione (PubChem CID 143150269) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione.
| Compound Name | (9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione |
|---|---|
| PubChem CID | 143150269 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (9R,11E,13E,15R,16R)-9,13,16-trimethyl-15-[[(2R,6R)-6-methyloxan-2-yl]oxymethyl]-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| SMILES | CC1=C\[C@H](CO[C@H]2CCC[C@@H](C)O2)[C@@H](C)OC(=O)CCCCCC[C@@H](C)C(=O)\C=C\1 |
| InChI | InChI=1S/C25H40O5/c1-18-14-15-23(26)19(2)10-7-5-6-8-12-24(27)30-21(4)22(16-18)17-28-25-13-9-11-20(3)29-25/h14-16,19-22,25H,5-13,17H2,1-4H3/b15-14+,18-16+/t19-,20-,21-,22-,25-/m1/s1 |
| InChIKey | JJJNNMWCDBSDHM-PHOAIOFYSA-N |
| XLogP | 5.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |