C19H26FN3O5 — CID 143150401
ethane;5-fluoro-3-[[2-[2-(2-methylanilino)prop-2-enoylamino]acetyl]amino]-4-oxopentanoic acid (PubChem CID 143150401) has the molecular formula C19H26FN3O5 and a molecular weight of 395.43 g/mol. Its IUPAC name is ethane;5-fluoro-3-[[2-[2-(2-methylanilino)prop-2-enoylamino]acetyl]amino]-4-oxopentanoic acid.
| Compound Name | ethane;5-fluoro-3-[[2-[2-(2-methylanilino)prop-2-enoylamino]acetyl]amino]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 143150401 |
| Molecular Formula | C19H26FN3O5 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | ethane;5-fluoro-3-[[2-[2-(2-methylanilino)prop-2-enoylamino]acetyl]amino]-4-oxopentanoic acid |
| SMILES | C=C(Nc1ccccc1C)C(=O)NCC(=O)NC(CC(=O)O)C(=O)CF.CC |
| InChI | InChI=1S/C17H20FN3O5.C2H6/c1-10-5-3-4-6-12(10)20-11(2)17(26)19-9-15(23)21-13(7-16(24)25)14(22)8-18;1-2/h3-6,13,20H,2,7-9H2,1H3,(H,19,26)(H,21,23)(H,24,25);1-2H3 |
| InChIKey | UWGUSIGQYCQWGD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|