C15H27O3Tl — CID 143150607
3-(3a-ethyl-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl)propoxythallium (PubChem CID 143150607) has the molecular formula C15H27O3Tl and a molecular weight of 459.76 g/mol. Its IUPAC name is 3-(3a-ethyl-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl)propoxythallium.
| Compound Name | 3-(3a-ethyl-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl)propoxythallium |
|---|---|
| PubChem CID | 143150607 |
| Molecular Formula | C15H27O3Tl |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-(3a-ethyl-5-propyl-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl)propoxythallium |
| SMILES | CCCC1CCC2OC(CCCO[Tl])CC2(CC)O1 |
| InChI | InChI=1S/C15H27O3.Tl/c1-3-6-12-8-9-14-15(4-2,18-12)11-13(17-14)7-5-10-16;/h12-14H,3-11H2,1-2H3;/q-1;+1 |
| InChIKey | SOJOKOPVOCTJJH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|