C9H15F3N2O — CID 143150912
(2S)-2-[[(E)-4,5,5-trifluoropent-2-enyl]amino]butanamide (PubChem CID 143150912) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is (2S)-2-[[(E)-4,5,5-trifluoropent-2-enyl]amino]butanamide.
| Compound Name | (2S)-2-[[(E)-4,5,5-trifluoropent-2-enyl]amino]butanamide |
|---|---|
| PubChem CID | 143150912 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (2S)-2-[[(E)-4,5,5-trifluoropent-2-enyl]amino]butanamide |
| SMILES | CC[C@H](NC/C=C/C(F)C(F)F)C(N)=O |
| InChI | InChI=1S/C9H15F3N2O/c1-2-7(9(13)15)14-5-3-4-6(10)8(11)12/h3-4,6-8,14H,2,5H2,1H3,(H2,13,15)/b4-3+/t6?,7-/m0/s1 |
| InChIKey | OYPBXLQVXQHQIG-SEDYBDSGSA-N |
| XLogP | 1.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|