About 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen
1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen (PubChem CID 143151376) has the molecular formula C10H19F2N3
and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen |
| PubChem CID | 143151376 |
| Molecular Formula | C10H19F2N3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen |
| SMILES | CC.CC(F)(F)c1ccnn1C1CNC1.[H][H] |
| InChI | InChI=1S/C8H11F2N3.C2H6.H2/c1-8(9,10)7-2-3-12-13(7)6-4-11-5-6;1-2;/h2-3,6,11H,4-5H2,1H3;1-2H3;1H |
| InChIKey | HBXMYGXWUGBATD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen?
The IUPAC name of 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen (CID 143151376) is 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen.
What is the SMILES notation for 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen?
The canonical SMILES for 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen is CC.CC(F)(F)c1ccnn1C1CNC1.[H][H].
What is the InChIKey of 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen?
The InChIKey is HBXMYGXWUGBATD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3.C2H6.H2/c1-8(9,10)7-2-3-12-13(7)6-4-11-5-6;1-2;/h2-3,6,11H,4-5H2,1H3;1-2H3;1H.
What are the key properties of 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen?
1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen has a molecular weight of 219.28 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-5-(1,1-difluoroethyl)pyrazole;ethane;molecular hydrogen is sourced from PubChem (CID 143151376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).