C19H20ClFN4O3P2 — CID 143151589
[4-[3-chloro-4-[fluoro-bis(phosphanyl)methoxy]anilino]-1H-pyrrolo[3,2-c]pyridin-7-yl]-morpholin-4-ylmethanone (PubChem CID 143151589) has the molecular formula C19H20ClFN4O3P2 and a molecular weight of 468.79 g/mol. Its IUPAC name is [4-[3-chloro-4-[fluoro-bis(phosphanyl)methoxy]anilino]-1H-pyrrolo[3,2-c]pyridin-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[3-chloro-4-[fluoro-bis(phosphanyl)methoxy]anilino]-1H-pyrrolo[3,2-c]pyridin-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 143151589 |
| Molecular Formula | C19H20ClFN4O3P2 |
| Molecular Weight | 468.79 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [4-[3-chloro-4-[fluoro-bis(phosphanyl)methoxy]anilino]-1H-pyrrolo[3,2-c]pyridin-7-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cnc(Nc2ccc(OC(F)(P)P)c(Cl)c2)c2cc[nH]c12)N1CCOCC1 |
| InChI | InChI=1S/C19H20ClFN4O3P2/c20-14-9-11(1-2-15(14)28-19(21,29)30)24-17-12-3-4-22-16(12)13(10-23-17)18(26)25-5-7-27-8-6-25/h1-4,9-10,22H,5-8,29-30H2,(H,23,24) |
| InChIKey | VRFPFSKODXTRET-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|