C24H30BrF3N4O — CID 143151634
N-[2-bromo-4-(2,2,2-trifluoroethyl)phenyl]-4-methyl-5-(morpholine-4-carboximidoyl)-3-[(Z)-prop-1-enyl]pyridin-2-amine;ethane (PubChem CID 143151634) has the molecular formula C24H30BrF3N4O and a molecular weight of 527.43 g/mol. Its IUPAC name is N-[2-bromo-4-(2,2,2-trifluoroethyl)phenyl]-4-methyl-5-(morpholine-4-carboximidoyl)-3-[(Z)-prop-1-enyl]pyridin-2-amine;ethane.
| Compound Name | N-[2-bromo-4-(2,2,2-trifluoroethyl)phenyl]-4-methyl-5-(morpholine-4-carboximidoyl)-3-[(Z)-prop-1-enyl]pyridin-2-amine;ethane |
|---|---|
| PubChem CID | 143151634 |
| Molecular Formula | C24H30BrF3N4O |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | N-[2-bromo-4-(2,2,2-trifluoroethyl)phenyl]-4-methyl-5-(morpholine-4-carboximidoyl)-3-[(Z)-prop-1-enyl]pyridin-2-amine;ethane |
| SMILES | CC.[H]/N=C(/c1cnc(Nc2ccc(CC(F)(F)F)cc2Br)c(/C=C\C)c1C)N1CCOCC1 |
| InChI | InChI=1S/C22H24BrF3N4O.C2H6/c1-3-4-16-14(2)17(20(27)30-7-9-31-10-8-30)13-28-21(16)29-19-6-5-15(11-18(19)23)12-22(24,25)26;1-2/h3-6,11,13,27H,7-10,12H2,1-2H3,(H,28,29);1-2H3/b4-3-,27-20-; |
| InChIKey | PUECNQMKNITXRX-PDTIXWPCSA-N |
| XLogP | 6.72 |
| TPSA | 61.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|