C8H10N2S — CID 143151788
2-(5-sulfanyl-1,2,3,6-tetrahydropyridin-4-yl)prop-2-enenitrile (PubChem CID 143151788) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 2-(5-sulfanyl-1,2,3,6-tetrahydropyridin-4-yl)prop-2-enenitrile.
| Compound Name | 2-(5-sulfanyl-1,2,3,6-tetrahydropyridin-4-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 143151788 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-(5-sulfanyl-1,2,3,6-tetrahydropyridin-4-yl)prop-2-enenitrile |
| SMILES | C=C(C#N)C1=C(S)CNCC1 |
| InChI | InChI=1S/C8H10N2S/c1-6(4-9)7-2-3-10-5-8(7)11/h10-11H,1-3,5H2 |
| InChIKey | QAZRKIBTISLIEE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|