C17H15BrO2 — CID 143151829
6-bromo-10-(2-hydroxyethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one (PubChem CID 143151829) has the molecular formula C17H15BrO2 and a molecular weight of 331.21 g/mol. Its IUPAC name is 6-bromo-10-(2-hydroxyethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one.
| Compound Name | 6-bromo-10-(2-hydroxyethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 143151829 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 6-bromo-10-(2-hydroxyethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-one |
| SMILES | O=C1c2ccc(Br)cc2CC(CCO)c2ccccc21 |
| InChI | InChI=1S/C17H15BrO2/c18-13-5-6-15-12(10-13)9-11(7-8-19)14-3-1-2-4-16(14)17(15)20/h1-6,10-11,19H,7-9H2 |
| InChIKey | VSUIHTRQIHVRPT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |