About ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene
ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene (PubChem CID 143151929) has the molecular formula C16H23F
and a molecular weight of 234.36 g/mol. Its IUPAC name is ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene |
| PubChem CID | 143151929 |
| Molecular Formula | C16H23F |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene |
| SMILES | CC.CC1C=CC=CC1.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C7H10.C2H6/c1-6-4-2-3-5-7(6)8;1-7-5-3-2-4-6-7;1-2/h2-5H,1H3;2-5,7H,6H2,1H3;1-2H3 |
| InChIKey | AGFOGNURMNFYRJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene?
The IUPAC name of ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene (CID 143151929) is ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene.
What is the SMILES notation for ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene?
The canonical SMILES for ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene is CC.CC1C=CC=CC1.Cc1ccccc1F.
What is the InChIKey of ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene?
The InChIKey is AGFOGNURMNFYRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C7H10.C2H6/c1-6-4-2-3-5-7(6)8;1-7-5-3-2-4-6-7;1-2/h2-5H,1H3;2-5,7H,6H2,1H3;1-2H3.
What are the key properties of ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene?
ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene has a molecular weight of 234.36 g/mol, XLogP of 5.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-2-methylbenzene;5-methylcyclohexa-1,3-diene is sourced from PubChem (CID 143151929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).