C37H73N7 — CID 143152127
(Z)-but-2-ene;5-[(2E,4E)-3-methyl-6-(4-propyl-1,4,8-triazacyclotetradec-8-yl)hexa-2,4-dienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane (PubChem CID 143152127) has the molecular formula C37H73N7 and a molecular weight of 616.04 g/mol. Its IUPAC name is (Z)-but-2-ene;5-[(2E,4E)-3-methyl-6-(4-propyl-1,4,8-triazacyclotetradec-8-yl)hexa-2,4-dienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane.
| Compound Name | (Z)-but-2-ene;5-[(2E,4E)-3-methyl-6-(4-propyl-1,4,8-triazacyclotetradec-8-yl)hexa-2,4-dienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane |
|---|---|
| PubChem CID | 143152127 |
| Molecular Formula | C37H73N7 |
| Molecular Weight | 616.04 g/mol |
| Exact Mass | 615.59 |
| IUPAC Name | (Z)-but-2-ene;5-[(2E,4E)-3-methyl-6-(4-propyl-1,4,8-triazacyclotetradec-8-yl)hexa-2,4-dienyl]-1,5,8,12-tetrazabicyclo[10.2.2]hexadecane |
| SMILES | C/C=C\C.CCCN1CCCN(C/C=C/C(C)=C/CN2CCCN3CCN(CCCNCC2)CC3)CCCCCCNCC1 |
| InChI | InChI=1S/C33H65N7.C4H8/c1-3-18-36-22-10-23-37(19-7-5-4-6-14-34-16-27-36)20-8-12-33(2)13-26-38-24-11-25-40-31-29-39(30-32-40)21-9-15-35-17-28-38;1-3-4-2/h8,12-13,34-35H,3-7,9-11,14-32H2,1-2H3;3-4H,1-2H3/b12-8+,33-13+;4-3- |
| InChIKey | GQPOKHWAXRBNKP-FDHVFANMSA-N |
| XLogP | 4.94 |
| TPSA | 40.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.04 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|