C23H21BrN5O+ — CID 143152154
8-benzyl-3-(4-bromophenyl)-12-methoxy-2,4,5,11-tetraza-8-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene (PubChem CID 143152154) has the molecular formula C23H21BrN5O+ and a molecular weight of 463.36 g/mol. Its IUPAC name is 8-benzyl-3-(4-bromophenyl)-12-methoxy-2,4,5,11-tetraza-8-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene.
| Compound Name | 8-benzyl-3-(4-bromophenyl)-12-methoxy-2,4,5,11-tetraza-8-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene |
|---|---|
| PubChem CID | 143152154 |
| Molecular Formula | C23H21BrN5O+ |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 8-benzyl-3-(4-bromophenyl)-12-methoxy-2,4,5,11-tetraza-8-azoniatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene |
| SMILES | COc1ccc2c(n1)C[NH+](Cc1ccccc1)Cc1nnc(-c3ccc(Br)cc3)n1-2 |
| InChI | InChI=1S/C23H20BrN5O/c1-30-22-12-11-20-19(25-22)14-28(13-16-5-3-2-4-6-16)15-21-26-27-23(29(20)21)17-7-9-18(24)10-8-17/h2-12H,13-15H2,1H3/p+1 |
| InChIKey | CVTSYLSMNAUORV-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |