About N,3-dimethylpyrimidin-4-imine;ethane
N,3-dimethylpyrimidin-4-imine;ethane (PubChem CID 143152236) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is N,3-dimethylpyrimidin-4-imine;ethane.
Molecular Properties
| Compound Name | N,3-dimethylpyrimidin-4-imine;ethane |
| PubChem CID | 143152236 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N,3-dimethylpyrimidin-4-imine;ethane |
| SMILES | C/N=c1\ccncn1C.CC |
| InChI | InChI=1S/C6H9N3.C2H6/c1-7-6-3-4-8-5-9(6)2;1-2/h3-5H,1-2H3;1-2H3/b7-6+; |
| InChIKey | YSKLYEOSMVJZBP-UHDJGPCESA-N |
| XLogP | 0.98 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,3-dimethylpyrimidin-4-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylpyrimidin-4-imine;ethane?
The IUPAC name of N,3-dimethylpyrimidin-4-imine;ethane (CID 143152236) is N,3-dimethylpyrimidin-4-imine;ethane.
What is the SMILES notation for N,3-dimethylpyrimidin-4-imine;ethane?
The canonical SMILES for N,3-dimethylpyrimidin-4-imine;ethane is C/N=c1\ccncn1C.CC.
What is the InChIKey of N,3-dimethylpyrimidin-4-imine;ethane?
The InChIKey is YSKLYEOSMVJZBP-UHDJGPCESA-N. The full InChI is InChI=1S/C6H9N3.C2H6/c1-7-6-3-4-8-5-9(6)2;1-2/h3-5H,1-2H3;1-2H3/b7-6+;.
What are the key properties of N,3-dimethylpyrimidin-4-imine;ethane?
N,3-dimethylpyrimidin-4-imine;ethane has a molecular weight of 153.23 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylpyrimidin-4-imine;ethane is sourced from PubChem (CID 143152236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).