About 4-(3,4-dimethylpyrazol-1-yl)benzenethiol
4-(3,4-dimethylpyrazol-1-yl)benzenethiol (PubChem CID 143152522) has the molecular formula C11H12N2S
and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-(3,4-dimethylpyrazol-1-yl)benzenethiol.
Molecular Properties
| Compound Name | 4-(3,4-dimethylpyrazol-1-yl)benzenethiol |
| PubChem CID | 143152522 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-(3,4-dimethylpyrazol-1-yl)benzenethiol |
| SMILES | Cc1cn(-c2ccc(S)cc2)nc1C |
| InChI | InChI=1S/C11H12N2S/c1-8-7-13(12-9(8)2)10-3-5-11(14)6-4-10/h3-7,14H,1-2H3 |
| InChIKey | KFGNCAZQXNPTLS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dimethylpyrazol-1-yl)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethylpyrazol-1-yl)benzenethiol?
The IUPAC name of 4-(3,4-dimethylpyrazol-1-yl)benzenethiol (CID 143152522) is 4-(3,4-dimethylpyrazol-1-yl)benzenethiol.
What is the SMILES notation for 4-(3,4-dimethylpyrazol-1-yl)benzenethiol?
The canonical SMILES for 4-(3,4-dimethylpyrazol-1-yl)benzenethiol is Cc1cn(-c2ccc(S)cc2)nc1C.
What is the InChIKey of 4-(3,4-dimethylpyrazol-1-yl)benzenethiol?
The InChIKey is KFGNCAZQXNPTLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S/c1-8-7-13(12-9(8)2)10-3-5-11(14)6-4-10/h3-7,14H,1-2H3.
What are the key properties of 4-(3,4-dimethylpyrazol-1-yl)benzenethiol?
4-(3,4-dimethylpyrazol-1-yl)benzenethiol has a molecular weight of 204.30 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethylpyrazol-1-yl)benzenethiol is sourced from PubChem (CID 143152522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).