C25H28F3N5O3 — CID 143152840
2-amino-N-[2-[[1-[(6-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide (PubChem CID 143152840) has the molecular formula C25H28F3N5O3 and a molecular weight of 503.53 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-[(6-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide.
| Compound Name | 2-amino-N-[2-[[1-[(6-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 143152840 |
| Molecular Formula | C25H28F3N5O3 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 2-amino-N-[2-[[1-[(6-methyl-1H-indol-3-yl)methyl]piperidin-4-yl]amino]-2-oxoethyl]-5-(trifluoromethoxy)benzamide |
| SMILES | Cc1ccc2c(CN3CCC(NC(=O)CNC(=O)c4cc(OC(F)(F)F)ccc4N)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C25H28F3N5O3/c1-15-2-4-19-16(12-30-22(19)10-15)14-33-8-6-17(7-9-33)32-23(34)13-31-24(35)20-11-18(3-5-21(20)29)36-25(26,27)28/h2-5,10-12,17,30H,6-9,13-14,29H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | SONXOYDPIZCUGR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|