C23H24ClFN2 — CID 143153255
2-[(4E,6Z)-8-chloro-1-(1-fluoro-1,2-dihydrobenzo[7]annulen-4-yl)-3-methylideneocta-4,6-dien-4-yl]-4,5-dihydro-1H-imidazole (PubChem CID 143153255) has the molecular formula C23H24ClFN2 and a molecular weight of 382.91 g/mol. Its IUPAC name is 2-[(4E,6Z)-8-chloro-1-(1-fluoro-1,2-dihydrobenzo[7]annulen-4-yl)-3-methylideneocta-4,6-dien-4-yl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[(4E,6Z)-8-chloro-1-(1-fluoro-1,2-dihydrobenzo[7]annulen-4-yl)-3-methylideneocta-4,6-dien-4-yl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 143153255 |
| Molecular Formula | C23H24ClFN2 |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-[(4E,6Z)-8-chloro-1-(1-fluoro-1,2-dihydrobenzo[7]annulen-4-yl)-3-methylideneocta-4,6-dien-4-yl]-4,5-dihydro-1H-imidazole |
| SMILES | C=C(CCC1=CCC(F)C2=C1C=C=CC=C2)/C(=C\C=C/CCl)C1=NCCN1 |
| InChI | InChI=1S/C23H24ClFN2/c1-17(19(7-5-6-14-24)23-26-15-16-27-23)10-11-18-12-13-22(25)21-9-4-2-3-8-20(18)21/h2,4-9,12,22H,1,10-11,13-16H2,(H,26,27)/b6-5-,19-7+ |
| InChIKey | KRFHSCOEEVRASR-RTCKQPGJSA-N |
| XLogP | 5.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|