About N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine
N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine (PubChem CID 143153491) has the molecular formula C20H31ClN2
and a molecular weight of 334.94 g/mol. Its IUPAC name is N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine |
| PubChem CID | 143153491 |
| Molecular Formula | C20H31ClN2 |
| Molecular Weight | 334.94 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine |
| SMILES | C=CCCCc1ccc(Cl)cc1N(CCCNC)C(C)/C=C\C |
| InChI | InChI=1S/C20H31ClN2/c1-5-7-8-11-18-12-13-19(21)16-20(18)23(15-9-14-22-4)17(3)10-6-2/h5-6,10,12-13,16-17,22H,1,7-9,11,14-15H2,2-4H3/b10-6- |
| InChIKey | ZNYQXTCWEAGSBF-POHAHGRESA-N |
| XLogP | 5.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine?
The IUPAC name of N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine (CID 143153491) is N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine.
What is the SMILES notation for N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine?
The canonical SMILES for N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine is C=CCCCc1ccc(Cl)cc1N(CCCNC)C(C)/C=C\C.
What is the InChIKey of N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine?
The InChIKey is ZNYQXTCWEAGSBF-POHAHGRESA-N. The full InChI is InChI=1S/C20H31ClN2/c1-5-7-8-11-18-12-13-19(21)16-20(18)23(15-9-14-22-4)17(3)10-6-2/h5-6,10,12-13,16-17,22H,1,7-9,11,14-15H2,2-4H3/b10-6-.
What are the key properties of N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine?
N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine has a molecular weight of 334.94 g/mol, XLogP of 5.23, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-chloro-2-pent-4-enylphenyl)-N-methyl-N'-[(Z)-pent-3-en-2-yl]propane-1,3-diamine is sourced from PubChem (CID 143153491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).