About ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate
ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate (PubChem CID 143153537) has the molecular formula C22H24O3S
and a molecular weight of 368.50 g/mol. Its IUPAC name is ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate.
Molecular Properties
| Compound Name | ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate |
| PubChem CID | 143153537 |
| Molecular Formula | C22H24O3S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate |
| SMILES | CC.CCCC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1 |
| InChI | InChI=1S/C20H18O3S.C2H6/c1-2-6-18(21)24-16-11-9-14(10-12-16)17-13-23-20(22)19(17)15-7-4-3-5-8-15;1-2/h3-5,7-12H,2,6,13H2,1H3;1-2H3 |
| InChIKey | GZUWBTFFNRSRTH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate?
The IUPAC name of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate (CID 143153537) is ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate.
What is the SMILES notation for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate?
The canonical SMILES for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate is CC.CCCC(=O)Sc1ccc(C2=C(c3ccccc3)C(=O)OC2)cc1.
What is the InChIKey of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate?
The InChIKey is GZUWBTFFNRSRTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O3S.C2H6/c1-2-6-18(21)24-16-11-9-14(10-12-16)17-13-23-20(22)19(17)15-7-4-3-5-8-15;1-2/h3-5,7-12H,2,6,13H2,1H3;1-2H3.
What are the key properties of ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate?
ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate has a molecular weight of 368.50 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;S-[4-(5-oxo-4-phenyl-2H-furan-3-yl)phenyl] butanethioate is sourced from PubChem (CID 143153537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).