N-(2-methylphenyl)propanamide;molecular hydrogen

C10H15NO — CID 143153627

IUPACN-(2-methylphenyl)propanamide;molecular hydrogen
SMILESCCC(=O)Nc1ccccc1C.[H][H]
InChIInChI=1S/C10H13NO.H2/c1-3-10(12)11-9-7-5-4-6-8(9)2;/h4-7H,3H2,1-2H3,(H,11,12);1H
InChIKeyFRQPBXAFEQTMPK-UHFFFAOYSA-N
MW165.24 g/mol
LogP2.59
Rot. Bonds2

About N-(2-methylphenyl)propanamide;molecular hydrogen

N-(2-methylphenyl)propanamide;molecular hydrogen (PubChem CID 143153627) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(2-methylphenyl)propanamide;molecular hydrogen.

Molecular Properties

Compound NameN-(2-methylphenyl)propanamide;molecular hydrogen
PubChem CID143153627
Molecular FormulaC10H15NO
Molecular Weight165.24 g/mol
Exact Mass165.12
IUPAC NameN-(2-methylphenyl)propanamide;molecular hydrogen
SMILESCCC(=O)Nc1ccccc1C.[H][H]
InChIInChI=1S/C10H13NO.H2/c1-3-10(12)11-9-7-5-4-6-8(9)2;/h4-7H,3H2,1-2H3,(H,11,12);1H
InChIKeyFRQPBXAFEQTMPK-UHFFFAOYSA-N
XLogP2.59
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.24
LogP ≤ 52.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze N-(2-methylphenyl)propanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-methylphenyl)propanamide;molecular hydrogen?
The IUPAC name of N-(2-methylphenyl)propanamide;molecular hydrogen (CID 143153627) is N-(2-methylphenyl)propanamide;molecular hydrogen.
What is the SMILES notation for N-(2-methylphenyl)propanamide;molecular hydrogen?
The canonical SMILES for N-(2-methylphenyl)propanamide;molecular hydrogen is CCC(=O)Nc1ccccc1C.[H][H].
What is the InChIKey of N-(2-methylphenyl)propanamide;molecular hydrogen?
The InChIKey is FRQPBXAFEQTMPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.H2/c1-3-10(12)11-9-7-5-4-6-8(9)2;/h4-7H,3H2,1-2H3,(H,11,12);1H.
What are the key properties of N-(2-methylphenyl)propanamide;molecular hydrogen?
N-(2-methylphenyl)propanamide;molecular hydrogen has a molecular weight of 165.24 g/mol, XLogP of 2.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylphenyl)propanamide;molecular hydrogen is sourced from PubChem (CID 143153627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).