C15H25NO6 — CID 143153987
methanol;methyl 2-[(3R,6Z,11R)-2-oxo-4,9-dioxa-1-azabicyclo[9.3.0]tetradec-6-en-3-yl]acetate (PubChem CID 143153987) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is methanol;methyl 2-[(3R,6Z,11R)-2-oxo-4,9-dioxa-1-azabicyclo[9.3.0]tetradec-6-en-3-yl]acetate.
| Compound Name | methanol;methyl 2-[(3R,6Z,11R)-2-oxo-4,9-dioxa-1-azabicyclo[9.3.0]tetradec-6-en-3-yl]acetate |
|---|---|
| PubChem CID | 143153987 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | methanol;methyl 2-[(3R,6Z,11R)-2-oxo-4,9-dioxa-1-azabicyclo[9.3.0]tetradec-6-en-3-yl]acetate |
| SMILES | CO.COC(=O)C[C@H]1OC/C=C\COC[C@H]2CCCN2C1=O |
| InChI | InChI=1S/C14H21NO5.CH4O/c1-18-13(16)9-12-14(17)15-6-4-5-11(15)10-19-7-2-3-8-20-12;1-2/h2-3,11-12H,4-10H2,1H3;2H,1H3/b3-2-;/t11-,12-;/m1./s1 |
| InChIKey | ZDHXGGDDJYHQIS-LUSRXDMOSA-N |
| XLogP | 0.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|