C23H35N3O5 — CID 143154119
(2R,3R)-N-[3-(2-ethenylpentanoylamino)propyl]-2,3-dihydroxy-N'-methyl-N'-(2-phenylethyl)butanediamide (PubChem CID 143154119) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2R,3R)-N-[3-(2-ethenylpentanoylamino)propyl]-2,3-dihydroxy-N'-methyl-N'-(2-phenylethyl)butanediamide.
| Compound Name | (2R,3R)-N-[3-(2-ethenylpentanoylamino)propyl]-2,3-dihydroxy-N'-methyl-N'-(2-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 143154119 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (2R,3R)-N-[3-(2-ethenylpentanoylamino)propyl]-2,3-dihydroxy-N'-methyl-N'-(2-phenylethyl)butanediamide |
| SMILES | C=CC(CCC)C(=O)NCCCNC(=O)[C@H](O)[C@@H](O)C(=O)N(C)CCc1ccccc1 |
| InChI | InChI=1S/C23H35N3O5/c1-4-10-18(5-2)21(29)24-14-9-15-25-22(30)19(27)20(28)23(31)26(3)16-13-17-11-7-6-8-12-17/h5-8,11-12,18-20,27-28H,2,4,9-10,13-16H2,1,3H3,(H,24,29)(H,25,30)/t18?,19-,20-/m1/s1 |
| InChIKey | GGLBLNZZJXBLRW-FXJNCMGBSA-N |
| XLogP | 0.63 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|