C31H33N3O4S — CID 143154150
2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)butan-1-one;N-[[4-(3-pyridin-4-ylthiophen-2-yl)phenyl]methyl]formamide (PubChem CID 143154150) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is 2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)butan-1-one;N-[[4-(3-pyridin-4-ylthiophen-2-yl)phenyl]methyl]formamide.
| Compound Name | 2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)butan-1-one;N-[[4-(3-pyridin-4-ylthiophen-2-yl)phenyl]methyl]formamide |
|---|---|
| PubChem CID | 143154150 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2,3-dihydroxy-1-(2-phenylpyrrolidin-1-yl)butan-1-one;N-[[4-(3-pyridin-4-ylthiophen-2-yl)phenyl]methyl]formamide |
| SMILES | CC(O)C(O)C(=O)N1CCCC1c1ccccc1.O=CNCc1ccc(-c2sccc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C17H14N2OS.C14H19NO3/c20-12-19-11-13-1-3-15(4-2-13)17-16(7-10-21-17)14-5-8-18-9-6-14;1-10(16)13(17)14(18)15-9-5-8-12(15)11-6-3-2-4-7-11/h1-10,12H,11H2,(H,19,20);2-4,6-7,10,12-13,16-17H,5,8-9H2,1H3 |
| InChIKey | XDUMCTAWQRFRGH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|