C18H26FNO — CID 143154581
(3E,5E,7Z)-8-ethoxy-3-[(1Z,3Z)-5-fluoropenta-1,3-dienyl]-2-methyldeca-3,5,7,9-tetraen-2-amine (PubChem CID 143154581) has the molecular formula C18H26FNO and a molecular weight of 291.41 g/mol. Its IUPAC name is (3E,5E,7Z)-8-ethoxy-3-[(1Z,3Z)-5-fluoropenta-1,3-dienyl]-2-methyldeca-3,5,7,9-tetraen-2-amine.
| Compound Name | (3E,5E,7Z)-8-ethoxy-3-[(1Z,3Z)-5-fluoropenta-1,3-dienyl]-2-methyldeca-3,5,7,9-tetraen-2-amine |
|---|---|
| PubChem CID | 143154581 |
| Molecular Formula | C18H26FNO |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (3E,5E,7Z)-8-ethoxy-3-[(1Z,3Z)-5-fluoropenta-1,3-dienyl]-2-methyldeca-3,5,7,9-tetraen-2-amine |
| SMILES | C=C/C(=C/C=C/C=C(\C=C/C=C\CF)C(C)(C)N)OCC |
| InChI | InChI=1S/C18H26FNO/c1-5-17(21-6-2)14-10-9-13-16(18(3,4)20)12-8-7-11-15-19/h5,7-14H,1,6,15,20H2,2-4H3/b10-9+,11-7-,12-8-,16-13+,17-14- |
| InChIKey | GDHPJYROBPUUCA-WAGFAQKLSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|